CAS 93701-32-7

1,3-Dibromo-2-(bromomethyl)benzene

Description:

1,3-Dibromo-2-(bromomethyl)benzene, with the CAS number 93701-32-7, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with two bromine atoms and a bromomethyl group. This compound typically appears as a colorless to pale yellow solid and is known for its reactivity due to the presence of multiple bromine substituents, which can participate in various chemical reactions, including nucleophilic substitutions and cross-coupling reactions. The presence of bromine atoms enhances its electrophilic character, making it useful in organic synthesis and as an intermediate in the production of other chemical compounds. Additionally, it may exhibit moderate to high toxicity, necessitating careful handling and appropriate safety measures during use. Its physical properties, such as melting point and solubility, can vary based on purity and specific conditions, but it is generally soluble in organic solvents. Overall, 1,3-Dibromo-2-(bromomethyl)benzene is significant in synthetic organic chemistry and materials science.

Formula: C₇H₅Br₃

InChI: InChI=1S/C7H5Br3/c8-4-5-6(9)2-1-3-7(5)10/h1-3H,4H2

InChI key: InChIKey=QFXJJFWSOLXOSE-UHFFFAOYSA-N

SMILES: C(Br)C1=C(Br)C=CC=C1Br

Synonyms:

• 1,3-Dibromo-2-(Bromomethyl)Benzene
• 2,6-Dibromobenzyl bromide
• Benzene, 1,3-dibromo-2-(bromomethyl)-

1,3-Dibromo-2-(bromomethyl)benzene

CAS: 93701-32-7

Formula: C₇H₅Br₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 328.8266

Ref: IN-DA006EN3

2,6-Dibromobenzyl bromide

CAS: 93701-32-7

2,6-Dibromobenzyl bromide

Purity: 97%

Molecular weight: 328.83g/mol

Ref: 54-OR71194

2,6-Dibromobenzyl Bromide

CAS: 93701-32-7

2,6-Dibromobenzyl Bromide is a reagent that is used in organic synthesis for the transfer of cholesterol esters. It reacts with anhydrous sodium sulfate to form 2,6-dibromobenzyl sulfate, which can then be hydrolyzed to 2,6-dibromobenzyl alcohol or brominated with carbon tetrachloride to produce 2,6-dibromobenzyl chloride. This product is typically used as a solution in solvents such as carbon tetrachloride or hydrogen peroxide. It is also used as a patterning agent when it is coated on a surface and exposed to light using magnetic or optical lithography.

Formula: C₇H₅Br₃

Purity: Min. 95%

Molecular weight: 328.83 g/mol

Ref: 3D-TDA70132