CymitQuimica logo

CAS 937014-02-3

:

5-Ethenyl-4-methyl-2-pyrimidinamine

Description:
5-Ethenyl-4-methyl-2-pyrimidinamine, identified by its CAS number 937014-02-3, is a chemical compound that belongs to the class of pyrimidines, which are heterocyclic aromatic organic compounds. This substance features a pyrimidine ring substituted with an ethenyl group at the 5-position and a methyl group at the 4-position, contributing to its unique reactivity and properties. Pyrimidines are known for their role in biological systems, particularly in nucleic acids, and can exhibit various biological activities. The presence of the ethenyl group may enhance its potential for polymerization or other chemical reactions. The compound's solubility, stability, and reactivity can vary depending on the solvent and environmental conditions. Additionally, its structural characteristics may allow it to participate in various chemical reactions, making it of interest in medicinal chemistry and material science. However, specific details regarding its toxicity, safety, and applications would require further investigation and should be referenced from safety data sheets or scientific literature.
Formula:C7H9N3
InChI:InChI=1S/C7H9N3/c1-3-6-4-9-7(8)10-5(6)2/h3-4H,1H2,2H3,(H2,8,9,10)
InChI key:InChIKey=FFEYPAMCSIPRHJ-UHFFFAOYSA-N
SMILES:C(=C)C=1C(C)=NC(N)=NC1
Synonyms:
  • 4-Methyl-5-vinylpyrimidin-2-amine
  • 2-Pyrimidinamine, 5-ethenyl-4-methyl-
  • 5-Ethenyl-4-methyl-2-pyrimidinamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.