CAS 937039-45-7

N-(2-aminophenyl)-N'-(4-methylphenyl)heptanediamide

Description:

N-(2-aminophenyl)-N'-(4-methylphenyl)heptanediamide, with the CAS number 937039-45-7, is a chemical compound characterized by its amide functional groups and a heptane backbone. This compound features two aromatic rings: one derived from 2-aminophenyl and the other from 4-methylphenyl, which contribute to its structural complexity and potential for various interactions. The presence of amino groups suggests that it may exhibit basic properties and participate in hydrogen bonding, influencing its solubility and reactivity. The heptanediamide structure indicates that it has a relatively long carbon chain, which can affect its physical properties, such as melting and boiling points, as well as its behavior in biological systems. This compound may have applications in medicinal chemistry or materials science, although specific uses would depend on its biological activity and stability. Overall, its unique structure positions it as a potentially interesting compound for further research in various chemical and pharmaceutical contexts.

Formula: C₂₀H₂₅N₃O₂

InChI: InChI=1/C20H25N3O2/c1-15-11-13-16(14-12-15)22-19(24)9-3-2-4-10-20(25)23-18-8-6-5-7-17(18)21/h5-8,11-14H,2-4,9-10,21H2,1H3,(H,22,24)(H,23,25)

SMILES: Cc1ccc(cc1)NC(=O)CCCCCC(=Nc1ccccc1N)O

TC-H 106

CAS: 937039-45-7

Formula: C₂₀H₂₅N₃O₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 339.4314

Ref: IN-DA00GTBM

Pimelic diphenylamide 106

CAS: 937039-45-7

Pimelic diphenylamide 106

Purity: ≥95%

Molecular weight: 339.43g/mol

Ref: 54-BUP11124

Pimelic diphenylamide 106

CAS: 937039-45-7

Pimelic diphenylamide 106 (RGFA-8) is a slow, tight-binding inhibitor of class I HDAC, showing no activity against class II HDACs.

Formula: C₂₀H₂₅N₃O₂

Purity: 95.25% - 99.28%

Color and Shape: Solid

Molecular weight: 339.43

Ref: TM-T3193