CymitQuimica logo

CAS 93706-76-4

:

3-(Perfluorooctyl)-2-hydroxypropyl methacrylate

Description:
3-(Perfluorooctyl)-2-hydroxypropyl methacrylate, with the CAS number 93706-76-4, is a fluorinated methacrylate compound characterized by the presence of a perfluorooctyl group, which imparts unique hydrophobic and lipophobic properties. This compound features a methacrylate functional group, making it polymerizable and suitable for use in various applications, including coatings, adhesives, and surface modification. The hydroxyl group in its structure enhances its reactivity and potential for hydrogen bonding, which can improve adhesion to substrates. The perfluorinated chain contributes to low surface energy, making it resistant to wetting by water and oils, thus providing excellent stain and dirt resistance. Additionally, the compound's fluorinated nature can enhance thermal and chemical stability, making it suitable for demanding environments. Overall, 3-(Perfluorooctyl)-2-hydroxypropyl methacrylate is valued in materials science for its unique combination of properties that facilitate the development of advanced materials with specialized functionalities.
Formula:C15H11F17O3
InChI:InChI=1/C15H11F17O3/c1-5(2)7(34)35-4-6(33)3-8(16,17)9(18,19)10(20,21)11(22,23)12(24,25)13(26,27)14(28,29)15(30,31)32/h6,33H,1,3-4H2,2H3
SMILES:C=C(C)C(=O)OCC(CC(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)O
Synonyms:
  • 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-Heptadecafluoro-2-Hydroxyundecyl 2-Methylprop-2-Enoate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.