
CAS 93709-68-3
:N-(3,4,5-Trimethoxybenzoyl)-L-valine
Description:
N-(3,4,5-Trimethoxybenzoyl)-L-valine is a chemical compound characterized by its structure, which includes a valine amino acid moiety linked to a benzoyl group that is further substituted with three methoxy groups at the 3, 4, and 5 positions of the aromatic ring. This compound is typically classified as a derivative of an amino acid and is known for its potential biological activity, which may include roles in medicinal chemistry or as a biochemical probe. The presence of the methoxy groups enhances the lipophilicity of the molecule, potentially influencing its solubility and permeability in biological systems. Additionally, the compound may exhibit specific interactions with biological targets due to the functional groups present, making it of interest in pharmaceutical research. Its CAS number, 93709-68-3, allows for easy identification and reference in chemical databases. As with many compounds, its stability, reactivity, and specific applications would depend on the conditions under which it is used.
Formula:C15H21NO6
InChI:InChI=1S/C15H21NO6/c1-8(2)12(15(18)19)16-14(17)9-6-10(20-3)13(22-5)11(7-9)21-4/h6-8,12H,1-5H3,(H,16,17)(H,18,19)/t12-/m0/s1
InChI key:InChIKey=QTUHHHIOMGXNRY-LBPRGKRZSA-N
SMILES:C(N[C@@H](C(C)C)C(O)=O)(=O)C1=CC(OC)=C(OC)C(OC)=C1
Synonyms:- L-Valine, N-(3,4,5-trimethoxybenzoyl)-
- (2S)-3-Methyl-2-[(3,4,5-trimethoxyphenyl)formamido]butanoic acid
- (S)-3-Methyl-2-(3,4,5-trimethoxybenzamido)butanoic acid
- N-(3,4,5-Trimethoxybenzoyl)-L-valine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.