CAS 93710-27-1

3a-ethyl-14a-hydroxy-2,3,3a,4,5,14a-hexahydroindolizino[8,1-ef][1]benzazonine-6,13(1H,7H)-dione

Description:

The chemical substance known as "3a-ethyl-14a-hydroxy-2,3,3a,4,5,14a-hexahydroindolizino[8,1-ef][1]benzazonine-6,13(1H,7H)-dione," with the CAS number 93710-27-1, is a complex organic compound characterized by its unique bicyclic structure that incorporates both indolizine and benzazonine moieties. This compound features multiple functional groups, including a hydroxy group and a diketone, which contribute to its reactivity and potential biological activity. The presence of the ethyl group enhances its hydrophobic characteristics, potentially influencing its solubility and interaction with biological membranes. The stereochemistry of the compound, indicated by the specific numbering of the carbon atoms, suggests that it may exhibit chiral properties, which can affect its pharmacological profile. Such compounds are often of interest in medicinal chemistry due to their potential therapeutic applications, particularly in the development of novel drugs. However, detailed studies on its biological activity, toxicity, and pharmacokinetics would be necessary to fully understand its implications in pharmaceutical contexts.

Formula: C₁₉H₂₂N₂O₃

InChI: InChI=1/C19H22N2O3/c1-2-18-9-5-11-21-17(23)12-14(19(18,21)24)13-6-3-4-7-15(13)20-16(22)8-10-18/h3-4,6-7,12,24H,2,5,8-11H2,1H3,(H,20,22)

SMILES: CCC12CCCN3C(=O)C=C(c4ccccc4N=C(CC1)O)C23O

Leuconolam

CAS: 93710-27-1

Formula: C₁₉H₂₂N₂O₃

Purity: 97.0%

Molecular weight: 326.3896

Ref: IN-DA00H0H8

Leuconolam

CAS: 93710-27-1

Leuconolam is a natural product of Alstonia, Apocynaceae.

Formula: C₁₉H₂₂N₂O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 326.39

Ref: TM-TN4430

Leuconolam

CAS: 93710-27-1

Formula: C₁₉H₂₂N₂O₃

Purity: 95%~99%

Color and Shape: Powder

Molecular weight: 326.396

Ref: BP-SBP00171

Leuconolam

CAS: 93710-27-1

Leuconolam is a biological control agent, which is a naturally derived compound used in integrated pest management. It originates from microbial or botanical sources, taking advantage of naturally occurring processes to combat pest populations. The mode of action involves disrupting the life cycle of target pests, often through inhibition of key physiological processes or by acting as a deterrent against feeding and reproduction.

Formula: C₁₉H₂₂N₂O₃

Purity: Min. 95%

Molecular weight: 326.4 g/mol

Ref: 3D-TDA71027