CAS 93710-53-3

1-Bromo-2-(chloromethyl)-3-methoxybenzene

Description:

1-Bromo-2-(chloromethyl)-3-methoxybenzene, with the CAS number 93710-53-3, is an organic compound characterized by the presence of a bromine atom, a chloromethyl group, and a methoxy group attached to a benzene ring. This compound features a bromine substituent at the first position, a chloromethyl group at the second position, and a methoxy group at the third position of the aromatic ring, contributing to its reactivity and potential applications in organic synthesis. The presence of halogen atoms (bromine and chlorine) typically enhances the compound's electrophilicity, making it useful in various chemical reactions, including nucleophilic substitutions. The methoxy group can also influence the compound's electronic properties and solubility. As with many halogenated compounds, 1-Bromo-2-(chloromethyl)-3-methoxybenzene may exhibit specific safety and environmental considerations, necessitating careful handling and disposal. Its unique structure allows for potential applications in pharmaceuticals, agrochemicals, and materials science, where it may serve as an intermediate in the synthesis of more complex molecules.

Formula: C₈H₈BrClO

InChI: InChI=1S/C8H8BrClO/c1-11-8-4-2-3-7(9)6(8)5-10/h2-4H,5H2,1H3

InChI key: InChIKey=QYEVQNIBCIPCFD-UHFFFAOYSA-N

SMILES: O(C)C1=C(CCl)C(Br)=CC=C1

Synonyms:

• 2-Bromo-6-methoxybenzyl chloride
• 1-Bromo-2-(chloromethyl)-3-methoxybenzene
• Benzene, 1-bromo-2-(chloromethyl)-3-methoxy-
• 2-Bromo-6-methoxybenzylchloride