CAS 93713-35-0
:(2R,5R)-2,5-Pyrrolidinedicarboxylic acid
Description:
(2R,5R)-2,5-Pyrrolidinedicarboxylic acid, also known as L-pyrrolidine-2,5-dicarboxylic acid, is a bicyclic organic compound characterized by its pyrrolidine ring structure with two carboxylic acid functional groups at the 2 and 5 positions. This compound is a chiral molecule, exhibiting two stereocenters, which contributes to its specific optical activity. It is typically a white to off-white crystalline solid and is soluble in water due to the presence of the polar carboxylic acid groups. The compound is of interest in various fields, including pharmaceuticals and biochemistry, as it can serve as a building block for the synthesis of more complex molecules. Its derivatives may exhibit biological activity, making it a subject of research in medicinal chemistry. Additionally, the presence of the carboxylic acid groups allows for potential interactions in biochemical pathways, which can be explored for therapeutic applications. Overall, (2R,5R)-2,5-Pyrrolidinedicarboxylic acid is a versatile compound with significant implications in chemical synthesis and biological research.
Formula:C6H9NO4
InChI:InChI=1/C6H9NO4/c8-5(9)3-1-2-4(7-3)6(10)11/h3-4,7H,1-2H2,(H,8,9)(H,10,11)/t3-,4-/m1/s1
SMILES:C1C[C@H](C(=O)O)N[C@H]1C(=O)O
Synonyms:- (2R,5R)-Pyrrolidine-2,5-dicarboxylic acid
- 2,5-pyrrolidinedicarboxylic acid, (2R,5R)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.