CymitQuimica logo

CAS 93713-36-1

:

(2R,5R)-1-(Phenylmethyl)-2,5-pyrrolidinedimethanol

Description:
(2R,5R)-1-(Phenylmethyl)-2,5-pyrrolidinedimethanol, with the CAS number 93713-36-1, is a chiral organic compound characterized by its pyrrolidine ring structure, which contains two hydroxymethyl groups at the 2 and 5 positions. This compound exhibits a specific stereochemistry, denoted by the (2R,5R) configuration, indicating the spatial arrangement of its atoms, which is crucial for its biological activity and interaction with other molecules. The presence of the phenylmethyl group contributes to its hydrophobic characteristics, potentially influencing its solubility and reactivity. As a diol, it can participate in hydrogen bonding, which may enhance its interactions in biological systems. The compound's unique structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, where stereochemistry plays a vital role in drug efficacy and safety. Its properties, such as melting point, boiling point, and solubility, would typically be determined through experimental methods, as they are essential for understanding its behavior in various chemical environments.
Formula:C13H19NO2
InChI:InChI=1S/C13H19NO2/c15-9-12-6-7-13(10-16)14(12)8-11-4-2-1-3-5-11/h1-5,12-13,15-16H,6-10H2/t12-,13-/m1/s1
InChI key:InChIKey=KDHJNPHFSBLEMM-CHWSQXEVSA-N
SMILES:C(N1[C@@H](CO)CC[C@@H]1CO)C2=CC=CC=C2
Synonyms:
  • 2,5-Pyrrolidinedimethanol, 1-(phenylmethyl)-, (2R-trans)-
  • (2R,5R)-1-(Phenylmethyl)-2,5-pyrrolidinedimethanol
  • 2,5-Pyrrolidinedimethanol, 1-(phenylmethyl)-, (2R,5R)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.