CymitQuimica logo

CAS 937263-44-0

:

7-(2-Methyl-4-nitrophenoxy)[1,2,4]triazolo[1,5-a]pyridine

Description:
7-(2-Methyl-4-nitrophenoxy)[1,2,4]triazolo[1,5-a]pyridine is a chemical compound characterized by its complex structure, which includes a triazole ring fused to a pyridine moiety. This compound features a nitrophenoxy substituent, which contributes to its potential biological activity and solubility properties. The presence of the nitro group suggests that it may exhibit electron-withdrawing characteristics, influencing its reactivity and interactions with other molecules. The methyl group on the phenoxy ring can affect steric hindrance and overall molecular conformation. This compound may be of interest in medicinal chemistry, particularly for its potential applications in drug development, as compounds with similar structures have been explored for various pharmacological activities. Additionally, its unique structural features may allow for specific interactions with biological targets, making it a candidate for further research in the fields of biochemistry and pharmacology. As with any chemical substance, safety and handling precautions should be observed, given the potential hazards associated with nitro compounds.
Formula:C13H10N4O3
InChI:InChI=1S/C13H10N4O3/c1-9-6-10(17(18)19)2-3-12(9)20-11-4-5-16-13(7-11)14-8-15-16/h2-8H,1H3
InChI key:InChIKey=RYAGSLNGXGMZRV-UHFFFAOYSA-N
SMILES:O(C1=CC=2N(C=C1)N=CN2)C3=C(C)C=C(N(=O)=O)C=C3
Synonyms:
  • 7-(2-Methyl-4-nitrophenoxy)[1,2,4]triazolo[1,5-a]pyridine
  • [1,2,4]Triazolo[1,5-a]pyridine, 7-(2-methyl-4-nitrophenoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.