CAS 937265-83-3

6-[5-({[2-(Methylsulfonyl)ethyl]amino}methyl)-2-furyl]-N-[3-methyl-4-([1,2,4]triazolo[1,5-a]pyridin-7-yloxy)phenyl]-4-quinazolinamine

Description:

The chemical substance known as 6-[5-({[2-(Methylsulfonyl)ethyl]amino}methyl)-2-furyl]-N-[3-methyl-4-([1,2,4]triazolo[1,5-a]pyridin-7-yloxy)phenyl]-4-quinazolinamine, with the CAS number 937265-83-3, is a complex organic compound characterized by its multi-functional structure. It features a quinazolinamine core, which is a bicyclic compound known for its biological activity, particularly in medicinal chemistry. The presence of a furyl group and a triazolo-pyridine moiety suggests potential interactions with biological targets, making it of interest in drug development. The methylsulfonyl group enhances solubility and may influence pharmacokinetic properties. This compound is likely to exhibit specific biological activities, potentially as an inhibitor or modulator in various biochemical pathways. Its intricate structure indicates that it may interact with multiple targets, which is common in compounds designed for therapeutic applications. Overall, this substance exemplifies the complexity and diversity of modern medicinal chemistry, where structural modifications can lead to significant variations in biological activity and therapeutic potential.

Formula: C₂₉H₂₇N₇O₄S

InChI: InChI=1S/C29H27N7O4S/c1-19-13-21(4-7-26(19)39-22-9-11-36-28(15-22)32-18-34-36)35-29-24-14-20(3-6-25(24)31-17-33-29)27-8-5-23(40-27)16-30-10-12-41(2,37)38/h3-9,11,13-15,17-18,30H,10,12,16H2,1-2H3,(H,31,33,35)

SMILES: Cc1cc(ccc1Oc1ccn2c(c1)ncn2)Nc1c2cc(ccc2ncn1)c1ccc(CNCCS(=O)(=O)C)o1

Synonyms:

• Arry-380

ARRY-380

CAS: 937265-83-3

Formula: C₂₉H₂₇N₇O₄S

Purity: 98%

Molecular weight: 569.6342

Ref: IN-DA00GU0X

ARRY-380 (analog )

CAS: 937265-83-3

ARRY-380 (analog )

Purity: ≥98%

Molecular weight: 569.63g/mol

Ref: 54-BUP11494

ARRY-380 (analog )

CAS: 937265-83-3

ARRY-380 analog (HER2-Inhibitor-1) is a potent and selective HER2 inhibitor.

Formula: C₂₉H₂₇N₇O₄S

Purity: 99.82%

Color and Shape: Solid

Molecular weight: 569.63

Ref: TM-T2518