CymitQuimica logo

CAS 937372-45-7

:

4-(10-Bromo-9-anthracenyl)benzonitrile

Description:
4-(10-Bromo-9-anthracenyl)benzonitrile is an organic compound characterized by its complex structure, which includes an anthracene moiety substituted with a bromine atom and a benzonitrile group. This compound typically exhibits properties associated with both aromatic systems, such as high stability and distinct electronic characteristics due to the presence of conjugated pi systems. The bromine substitution can influence its reactivity and solubility, often enhancing its ability to participate in electrophilic substitution reactions. Additionally, the presence of the nitrile group contributes to its polar character, which can affect its solubility in various solvents. This compound may also exhibit interesting photophysical properties, making it potentially useful in applications such as organic electronics, photonic devices, or as a fluorescent probe. Its synthesis and characterization would typically involve standard organic chemistry techniques, including purification methods like chromatography and spectroscopic analysis for confirmation of structure. Overall, 4-(10-Bromo-9-anthracenyl)benzonitrile represents a versatile compound with potential applications in advanced materials science.
Formula:C21H12BrN
InChI:InChI=1S/C21H12BrN/c22-21-18-7-3-1-5-16(18)20(17-6-2-4-8-19(17)21)15-11-9-14(13-23)10-12-15/h1-12H
InChI key:InChIKey=RNHJKKXBUXNXPB-UHFFFAOYSA-N
SMILES:BrC=1C2=C(C(=C3C1C=CC=C3)C4=CC=C(C#N)C=C4)C=CC=C2
Synonyms:
  • Benzonitrile, 4-(10-bromo-9-anthracenyl)-
  • 4-(10-Bromo-9-anthracenyl)benzonitrile
  • 9-Bromo-10-benzonitrileanthracene
  • 4-(10-bromoanthracen-9-yl)benzonitrile
  • 4-(10-Bromo-9-anthryl)benzonitrile
Found 4 products.