
CAS 93748-31-3
:3-Chloro-β,β-dimethylbenzeneethanol
Description:
3-Chloro-β,β-dimethylbenzeneethanol, also known by its CAS number 93748-31-3, is an organic compound characterized by the presence of a chlorinated aromatic ring and an alcohol functional group. This compound features a benzene ring substituted with two methyl groups at the beta positions relative to the hydroxyl group, along with a chlorine atom at the meta position. The presence of the hydroxyl group imparts polar characteristics, making the compound capable of hydrogen bonding, which can influence its solubility in various solvents. The chlorinated aromatic structure may contribute to its reactivity and potential applications in organic synthesis or as an intermediate in the production of other chemical compounds. Additionally, the steric hindrance introduced by the dimethyl groups can affect the compound's physical properties, such as boiling point and melting point, as well as its reactivity in chemical reactions. Overall, 3-Chloro-β,β-dimethylbenzeneethanol is a compound of interest in both industrial and research contexts due to its unique structural features.
Formula:C10H13ClO
InChI:InChI=1S/C10H13ClO/c1-10(2,7-12)8-4-3-5-9(11)6-8/h3-6,12H,7H2,1-2H3
InChI key:InChIKey=MAPZIQZDTJLXRU-UHFFFAOYSA-N
SMILES:C(CO)(C)(C)C1=CC(Cl)=CC=C1
Synonyms:- 3-Chloro-β,β-dimethylbenzeneethanol
- 2-(3-Chlorophenyl)-2-methylpropan-1-ol
- Benzeneethanol, 3-chloro-β,β-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.