CymitQuimica logo

CAS 93752-78-4

:

(8Z)-5-hydroxy-8-[hydroxy(methoxy)methylidene]-2-methyl-4H,6H-pyrano[3,4-g]chromene-4,6,9(8H)-trione

Description:
The chemical substance known as (8Z)-5-hydroxy-8-[hydroxy(methoxy)methylidene]-2-methyl-4H,6H-pyrano[3,4-g]chromene-4,6,9(8H)-trione, with the CAS number 93752-78-4, is a complex organic compound characterized by its unique structural features. It belongs to the class of pyranochromene derivatives, which are known for their diverse biological activities. This compound contains multiple functional groups, including hydroxyl and methoxy groups, contributing to its potential reactivity and solubility properties. The presence of the pyrano and chromene moieties suggests that it may exhibit interesting photochemical and pharmacological properties. Additionally, the specific stereochemistry indicated by the "(8Z)" configuration implies a particular spatial arrangement that could influence its interactions with biological targets. Overall, this compound is of interest in the fields of medicinal chemistry and natural product research, where it may serve as a lead compound for the development of new therapeutic agents. Further studies would be necessary to elucidate its full range of properties and potential applications.
Formula:C15H10O8
InChI:InChI=1/C15H10O8/c1-5-3-7(16)10-8(22-5)4-6-9(12(10)18)14(19)23-13(11(6)17)15(20)21-2/h3-4,18,20H,1-2H3/b15-13-
SMILES:Cc1cc(=O)c2c(cc3c(c2O)C(=O)O/C(=C(/O)\OC)/C3=O)o1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.