CymitQuimica logo

CAS 93753-74-3

:

N-[(benzyloxy)carbonyl]-L-alanyl-N~5~-(diaminomethylidene)-L-ornithyl-N~5~-(diaminomethylidene)-N-[2-oxo-4-(trifluoromethyl)-2H-chromen-7-yl]ornithinamide

Description:
N-[(benzyloxy)carbonyl]-L-alanyl-N~5~-(diaminomethylidene)-L-ornithyl-N~5~-(diaminomethylidene)-N-[2-oxo-4-(trifluoromethyl)-2H-chromen-7-yl]ornithinamide, with CAS number 93753-74-3, is a complex organic compound characterized by its multi-functional structure. It features several key functional groups, including amides and a chromenyl moiety, which contribute to its potential biological activity. The presence of the benzyloxycarbonyl group suggests it may be involved in peptide synthesis or serve as a protective group in chemical reactions. The trifluoromethyl group enhances lipophilicity and may influence the compound's pharmacokinetic properties. Additionally, the diaminomethylidene groups indicate potential reactivity and interactions with biological targets, making it of interest in medicinal chemistry. Overall, this compound's intricate structure and diverse functional groups suggest it may exhibit unique properties and activities, warranting further investigation for applications in drug development or biochemical research.
Formula:C33H41F3N10O7
InChI:InChI=1/C33H41F3N10O7/c1-18(43-32(51)52-17-19-7-3-2-4-8-19)27(48)45-24(10-6-14-42-31(39)40)29(50)46-23(9-5-13-41-30(37)38)28(49)44-20-11-12-21-22(33(34,35)36)16-26(47)53-25(21)15-20/h2-4,7-8,11-12,15-16,18,23-24H,5-6,9-10,13-14,17H2,1H3,(H,43,51)(H,44,49)(H,45,48)(H,46,50)(H4,37,38,41)(H4,39,40,42)/t18-,23?,24-/m0/s1
SMILES:C[C@@H](C(=N[C@@H](CCCNC(=N)N)C(=NC(CCCNC(=N)N)C(=Nc1ccc2c(cc(=O)oc2c1)C(F)(F)F)O)O)O)N=C(O)OCc1ccccc1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.