CAS 937595-70-5
:5-Chloro-2-fluoropyridine-3-boronic acid
Description:
5-Chloro-2-fluoropyridine-3-boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a pyridine ring. This compound features a chlorine atom and a fluorine atom substituted at the 5 and 2 positions of the pyridine ring, respectively. The boronic acid group is known for its ability to form reversible covalent bonds with diols, making it valuable in various applications, particularly in organic synthesis and medicinal chemistry. The compound is typically a solid at room temperature and is soluble in polar organic solvents. Its unique structure allows it to participate in cross-coupling reactions, such as Suzuki-Miyaura coupling, which is widely used in the synthesis of complex organic molecules. Additionally, the presence of halogen substituents can influence the electronic properties of the molecule, potentially enhancing its reactivity. Safety data should be consulted for handling and storage, as with all chemical substances, to ensure proper precautions are taken.
Formula:C5H4BClFNO2
InChI:InChI=1/C5H4BClFNO2/c7-3-1-4(6(10)11)5(8)9-2-3/h1-2,10-11H
SMILES:c1c(cnc(c1B(O)O)F)Cl
Synonyms:- (5-Chloro-2-fluoropyridin-3-yl)boronic acid
- boronic acid, B-(5-chloro-2-fluoro-3-pyridinyl)-
- (5-Chloro-2-Fluoro-3-Pyridyl)Boronic Acid
- 5-Chloro-2-fluoropyridin-3-ylboronic acid
- 5-Chloro-2-fluoropyridine-3-boronic Acid (contains varying amounts of Anhydride)
- 5-Chloro-2-fluoro-3-pyridylboronic Acid
- 5-Chloro-2-fluoropyridine-3-boronic acid hydrate
- 5-Chloro-2-fluoropyridin-3-ylboronic acid ISO 9001:2015 REACH
- 5-Chloro-2-fluoropyridine-3-boronic acid
- 5-Chloro-2-Fluoropyridin-3-YlboronicAci
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
5-Chloro-2-Fluoropyridin-3-Ylboronic Acid
CAS:Formula:C5H4BClFNO2Purity:97%Color and Shape:SolidMolecular weight:175.35325-Chloro-2-fluoropyridine-3-boronic acid
CAS:<p>5-Chloro-2-fluoropyridine-3-boronic acid</p>Purity:97%Color and Shape:SolidMolecular weight:175.35g/mol5-Chloro-2-fluoropyridine-3-boronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C5H4BClFNO2Purity:97.0 to 111.0 %Color and Shape:White to Almost white powder to crystalMolecular weight:175.35(5-Chloro-2-fluoropyridin-3-yl)boronic acid
CAS:Formula:C5H4BClFNO2Purity:97%Color and Shape:SolidMolecular weight:175.35




