CAS 937595-71-6

2-Chloro-3-fluoropyridine-4-boronic acid

Description:

2-Chloro-3-fluoropyridine-4-boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a pyridine ring that is substituted with chlorine and fluorine atoms. This compound typically exhibits a white to off-white solid appearance and is soluble in polar solvents such as water and alcohols, owing to the boronic acid moiety. The presence of the chlorine and fluorine substituents can influence its reactivity and polarity, making it useful in various chemical reactions, particularly in Suzuki coupling reactions for the synthesis of biaryl compounds. Additionally, boronic acids are known for their ability to form reversible complexes with diols, which can be exploited in various applications, including drug delivery and sensor technology. The compound's unique structure allows it to participate in diverse chemical transformations, making it valuable in medicinal chemistry and materials science. Safety data should be consulted for handling and storage, as with all chemical substances.

Formula: C₅H₄BClFNO₂

InChI: InChI=1/C5H4BClFNO2/c7-5-4(8)3(6(10)11)1-2-9-5/h1-2,10-11H

SMILES: c1cnc(c(c1B(O)O)F)Cl

Synonyms:

• (2-Chloro-3-fluoropyridin-4-yl)boronic acid
• Boronic acid, B-(2-chloro-3-fluoro-4-pyridinyl)-
• (2-Chloro-3-Fluoro-4-Pyridyl)Boronic Acid

2-Chloro-3-fluoropyridine-4-boronic acid

CAS: 937595-71-6

Formula: C₅H₄BClFNO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 175.3532

Ref: IN-DA003GVJ

2-Chloro-3-fluoropyridine-4-boronic acid

CAS: 937595-71-6

2-Chloro-3-fluoropyridine-4-boronic acid

Formula: C₅H₄BClFNO₂

Purity: 96%

Color and Shape: white solid

Molecular weight: 175.35g/mol

Ref: 54-PC5054

2-Chloro-3-fluoropyridine-4-boronic acid

CAS: 937595-71-6

Formula: C₅H₄BClFNO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 175.35

Ref: 10-F219385