CAS 937596-38-8

2-[4,5,6,7-Tetrahydro-3-(trifluoromethyl)-1H-indazol-1-yl]-5-(trifluoromethyl)benzenamine

Description:

2-[4,5,6,7-Tetrahydro-3-(trifluoromethyl)-1H-indazol-1-yl]-5-(trifluoromethyl)benzenamine, with CAS number 937596-38-8, is a chemical compound characterized by its complex structure, which includes both indazole and trifluoromethyl groups. The presence of the tetrahydroindazole moiety contributes to its potential biological activity, as indazole derivatives are often explored for their pharmacological properties. The trifluoromethyl groups enhance lipophilicity and metabolic stability, which can influence the compound's interaction with biological targets. This compound is likely to exhibit unique physical and chemical properties, such as solubility in organic solvents and potential reactivity due to the presence of amine functional groups. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific receptors or enzymes. However, detailed studies on its biological activity, toxicity, and environmental impact would be necessary to fully understand its characteristics and potential uses.

Formula: C₁₅H₁₃F₆N₃

InChI: InChI=1S/C15H13F6N3/c16-14(17,18)8-5-6-12(10(22)7-8)24-11-4-2-1-3-9(11)13(23-24)15(19,20)21/h5-7H,1-4,22H2

InChI key: InChIKey=DANXTXUZFOZZCN-UHFFFAOYSA-N

SMILES: NC1=C(N2C3=C(C(C(F)(F)F)=N2)CCCC3)C=CC(C(F)(F)F)=C1