
CAS 937596-45-7
:2-[(2,3-Dihydro-1H-inden-5-yl)oxy]-5-fluorobenzenamine
Description:
2-[(2,3-Dihydro-1H-inden-5-yl)oxy]-5-fluorobenzenamine, with the CAS number 937596-45-7, is a chemical compound characterized by its unique structure that includes a fluorobenzene moiety and a dihydroindene group. This compound features an amine functional group, which contributes to its potential reactivity and solubility in various solvents. The presence of the fluorine atom enhances its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. The ether linkage between the dihydroindene and the fluorobenzene suggests potential for hydrogen bonding and interactions with biological targets. Additionally, the compound's molecular structure may impart specific conformational properties that can affect its pharmacokinetics and pharmacodynamics. Overall, this compound's characteristics make it a candidate for further investigation in drug development and other applications in organic synthesis.
Formula:C15H14FNO
InChI:InChI=1S/C15H14FNO/c16-12-5-7-15(14(17)9-12)18-13-6-4-10-2-1-3-11(10)8-13/h4-9H,1-3,17H2
InChI key:InChIKey=MWSXOVIKMZISOY-UHFFFAOYSA-N
SMILES:O(C=1C=C2C(=CC1)CCC2)C3=C(N)C=C(F)C=C3
Synonyms:- Benzenamine, 2-[(2,3-dihydro-1H-inden-5-yl)oxy]-5-fluoro-
- 2-[(2,3-Dihydro-1H-inden-5-yl)oxy]-5-fluorobenzenamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.