
CAS 937596-48-0
:2-(2,4-Dimethylphenoxy)-5-(trifluoromethyl)benzenamine
Description:
2-(2,4-Dimethylphenoxy)-5-(trifluoromethyl)benzenamine, identified by its CAS number 937596-48-0, is an organic compound characterized by its complex structure, which includes a phenoxy group and a trifluoromethyl substituent. This compound features a benzene ring substituted with both a dimethylphenyl group and an amino group, contributing to its potential as a versatile building block in organic synthesis. The presence of the trifluoromethyl group enhances its lipophilicity and may influence its biological activity, making it of interest in pharmaceutical research. Additionally, the dimethyl groups can affect the steric and electronic properties of the molecule, potentially impacting its reactivity and interactions with biological targets. As with many organic compounds, its solubility, stability, and reactivity can vary depending on the solvent and environmental conditions. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper usage in laboratory or industrial settings.
Formula:C15H14F3NO
InChI:InChI=1S/C15H14F3NO/c1-9-3-5-13(10(2)7-9)20-14-6-4-11(8-12(14)19)15(16,17)18/h3-8H,19H2,1-2H3
InChI key:InChIKey=GOLGBZMNBPUEPD-UHFFFAOYSA-N
SMILES:O(C1=C(N)C=C(C(F)(F)F)C=C1)C2=C(C)C=C(C)C=C2
Synonyms:- 2-(2,4-Dimethylphenoxy)-5-(trifluoromethyl)benzenamine
- Benzenamine, 2-(2,4-dimethylphenoxy)-5-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.