CAS 937596-82-2
:2-(2-Furanylmethoxy)-5-(trifluoromethyl)benzenamine
Description:
2-(2-Furanylmethoxy)-5-(trifluoromethyl)benzenamine, identified by its CAS number 937596-82-2, is an organic compound characterized by the presence of a furanyl group, a methoxy linkage, and a trifluoromethyl substituent on a benzene ring. The furanyl moiety contributes to its potential reactivity and interaction with biological systems, while the trifluoromethyl group enhances its lipophilicity and may influence its pharmacokinetic properties. This compound is likely to exhibit interesting electronic properties due to the electron-withdrawing nature of the trifluoromethyl group, which can affect its reactivity and stability. Additionally, the presence of an amine functional group suggests potential for hydrogen bonding, which may play a role in its solubility and interaction with other molecules. Overall, this compound may be of interest in medicinal chemistry and materials science, particularly in the development of novel pharmaceuticals or agrochemicals, although specific biological activities and applications would require further investigation.
Formula:C12H10F3NO2
InChI:InChI=1S/C12H10F3NO2/c13-12(14,15)8-3-4-11(10(16)6-8)18-7-9-2-1-5-17-9/h1-6H,7,16H2
InChI key:InChIKey=UPSXHBDHDPLACM-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=CC(N)=C(OCC2=CC=CO2)C=C1
Synonyms:- Benzenamine, 2-(2-furanylmethoxy)-5-(trifluoromethyl)-
- 2-(2-Furanylmethoxy)-5-(trifluoromethyl)benzenamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.