CAS 937596-93-5

5-Fluoro-2-[2-(4-morpholinyl)ethoxy]benzenamine

Description:

5-Fluoro-2-[2-(4-morpholinyl)ethoxy]benzenamine, with the CAS number 937596-93-5, is a chemical compound characterized by its aromatic amine structure, which includes a fluorine substituent and a morpholine group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, such as moderate solubility in organic solvents and potential reactivity due to the presence of the amine functional group. The fluorine atom can influence the compound's electronic properties, potentially enhancing its lipophilicity and biological activity. The morpholine moiety may contribute to its pharmacological profile, as morpholines are often found in various pharmaceuticals due to their ability to interact with biological targets. Overall, this compound may be of interest in medicinal chemistry and drug development, particularly in the context of designing agents with specific biological activities. Its precise characteristics, including melting point, boiling point, and spectral data, would require experimental determination or reference to specific literature for detailed analysis.

Formula: C₁₂H₁₇FN₂O₂

InChI: InChI=1S/C12H17FN2O2/c13-10-1-2-12(11(14)9-10)17-8-5-15-3-6-16-7-4-15/h1-2,9H,3-8,14H2

InChI key: InChIKey=LNEJHDOGQULOTB-UHFFFAOYSA-N

SMILES: O(CCN1CCOCC1)C2=C(N)C=C(F)C=C2

Synonyms:

• 5-Fluoro-2-[2-(4-morpholinyl)ethoxy]benzenamine
• Benzenamine, 5-fluoro-2-[2-(4-morpholinyl)ethoxy]-

5-Fluoro-2-[2-(morpholin-4-yl)ethoxy]aniline

CAS: 937596-93-5

Versatile small molecule scaffold

Formula: C₁₂H₁₇FN₂O₂

Purity: Min. 95%

Molecular weight: 240.27 g/mol

Ref: 3D-MMB59693