CAS 937597-61-0
:4-(2,3-Dihydro-1H-indol-1-yl)-3-fluorobenzenamine
Description:
4-(2,3-Dihydro-1H-indol-1-yl)-3-fluorobenzenamine, with the CAS number 937597-61-0, is an organic compound characterized by its complex structure that includes both an indole and a fluorobenzene moiety. This compound features a dihydroindole ring, which contributes to its potential biological activity, and a fluorine atom attached to a benzene ring, which can influence its electronic properties and reactivity. The presence of the amino group (-NH2) enhances its solubility in polar solvents and may facilitate interactions with biological targets. The compound is likely to exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its synthesis and characterization would typically involve standard organic reactions, and it may be evaluated for its efficacy in various biological assays. As with many compounds containing heterocycles and functional groups, its stability, reactivity, and potential applications in drug development or material science would be of significant interest to researchers in the field.
Formula:C14H13FN2
InChI:InChI=1S/C14H13FN2/c15-12-9-11(16)5-6-14(12)17-8-7-10-3-1-2-4-13(10)17/h1-6,9H,7-8,16H2
InChI key:InChIKey=CABWRBKWBIRRJR-UHFFFAOYSA-N
SMILES:FC1=C(N2C=3C(CC2)=CC=CC3)C=CC(N)=C1
Synonyms:- Benzenamine, 4-(2,3-dihydro-1H-indol-1-yl)-3-fluoro-
- 4-(2,3-Dihydro-1H-indol-1-yl)-3-fluorobenzenamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.