CAS 937597-62-1

3-Phenyl-6-(2-thienyl)isoxazolo[5,4-b]pyridine-4-carboxylic acid

Description:

3-Phenyl-6-(2-thienyl)isoxazolo[5,4-b]pyridine-4-carboxylic acid is a heterocyclic compound characterized by its complex structure, which includes an isoxazole ring fused to a pyridine system, along with phenyl and thienyl substituents. This compound typically exhibits properties associated with both aromatic and heteroaromatic systems, such as stability and potential for diverse chemical reactivity. The presence of the carboxylic acid functional group suggests it may participate in hydrogen bonding and act as a weak acid. Its unique structure may confer biological activity, making it of interest in medicinal chemistry and drug development. The compound's solubility, melting point, and other physical properties would depend on its specific molecular interactions and the presence of substituents. Additionally, its synthesis and characterization would involve standard organic chemistry techniques, including spectroscopy and chromatography, to confirm its identity and purity. Overall, this compound represents a fascinating area of study within the field of organic and medicinal chemistry.

Formula: C₁₇H₁₀N₂O₃S

InChI: InChI=1S/C17H10N2O3S/c20-17(21)11-9-12(13-7-4-8-23-13)18-16-14(11)15(19-22-16)10-5-2-1-3-6-10/h1-9H,(H,20,21)

InChI key: InChIKey=NGIWJFWRTBWGSQ-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C2C(=NOC2=NC(=C1)C3=CC=CS3)C4=CC=CC=C4

Synonyms:

• 3-Phenyl-6-(2-thienyl)isoxazolo[5,4-b]pyridine-4-carboxylic acid
• Isoxazolo[5,4-b]pyridine-4-carboxylic acid, 3-phenyl-6-(2-thienyl)-

3-phenyl-6-thien-2-ylisoxazolo[5,4-b]pyridine-4-carboxylic acid

CAS: 937597-62-1

Purity: 95.0%

Molecular weight: 322.3399963378906

Ref: 10-F426463

3-Phenyl-6-(thiophen-2-yl)-[1,2]oxazolo[5,4-b]pyridine-4-carboxylic acid

CAS: 937597-62-1

Versatile small molecule scaffold

Formula: C₁₇H₁₀N₂O₃S

Purity: Min. 95%

Molecular weight: 322.3 g/mol

Ref: 3D-MMB59762