CAS 937597-67-6

4-(2-Ethyl-1H-imidazol-1-yl)-3-fluorobenzenamine

Description:

4-(2-Ethyl-1H-imidazol-1-yl)-3-fluorobenzenamine, with the CAS number 937597-67-6, is a chemical compound characterized by its unique structure that combines an imidazole ring with a fluorobenzenamine moiety. This compound features a fluorine atom attached to the benzene ring, which can influence its reactivity and biological activity. The presence of the ethyl-substituted imidazole contributes to its potential as a ligand in coordination chemistry or as a pharmacophore in medicinal chemistry. The imidazole ring is known for its role in biological systems, particularly in enzyme catalysis and as a building block in various pharmaceuticals. The compound's solubility, stability, and reactivity can be influenced by the functional groups present, making it of interest in both synthetic and applied chemistry. Its specific applications may vary, but it could be explored in drug development or as an intermediate in organic synthesis. Further studies would be necessary to fully elucidate its properties and potential uses.

Formula: C₁₁H₁₂FN₃

InChI: InChI=1S/C11H12FN3/c1-2-11-14-5-6-15(11)10-4-3-8(13)7-9(10)12/h3-7H,2,13H2,1H3

InChI key: InChIKey=YYMYUROTYQICPP-UHFFFAOYSA-N

SMILES: C(C)C=1N(C=CN1)C2=C(F)C=C(N)C=C2

Synonyms:

• 4-(2-Ethyl-1H-imidazol-1-yl)-3-fluorobenzenamine
• Benzenamine, 4-(2-ethyl-1H-imidazol-1-yl)-3-fluoro-