CymitQuimica logo

CAS 937597-69-8

:

2-(3,4-Dihydro-1(2H)-quinolinyl)-5-fluorobenzenamine

Description:
2-(3,4-Dihydro-1(2H)-quinolinyl)-5-fluorobenzenamine, identified by its CAS number 937597-69-8, is a chemical compound that features a complex structure combining a quinoline derivative with a fluorobenzenamine moiety. This compound typically exhibits characteristics such as moderate to high lipophilicity due to the presence of aromatic rings, which can influence its solubility and permeability in biological systems. The fluorine atom in the 5-position of the benzene ring can enhance the compound's metabolic stability and alter its electronic properties, potentially affecting its biological activity. The presence of the quinoline structure may contribute to various pharmacological properties, making it of interest in medicinal chemistry. Additionally, the compound may exhibit specific reactivity patterns due to the amine functional group, which can participate in hydrogen bonding and nucleophilic reactions. Overall, this compound's unique structural features suggest potential applications in drug development, particularly in targeting specific biological pathways or receptors.
Formula:C15H15FN2
InChI:InChI=1S/C15H15FN2/c16-12-7-8-15(13(17)10-12)18-9-3-5-11-4-1-2-6-14(11)18/h1-2,4,6-8,10H,3,5,9,17H2
InChI key:InChIKey=WSWZTSTXFPTTIG-UHFFFAOYSA-N
SMILES:NC1=C(N2C=3C(CCC2)=CC=CC3)C=CC(F)=C1
Synonyms:
  • Benzenamine, 2-(3,4-dihydro-1(2H)-quinolinyl)-5-fluoro-
  • 2-(3,4-Dihydro-1(2H)-quinolinyl)-5-fluorobenzenamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.