CAS 937597-92-7
:Ethyl 2-[(2,5-dimethylphenyl)amino]-4-(trifluoromethyl)-5-thiazolecarboxylate
Description:
Ethyl 2-[(2,5-dimethylphenyl)amino]-4-(trifluoromethyl)-5-thiazolecarboxylate is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound features an ethyl ester functional group, contributing to its solubility and reactivity. The presence of a trifluoromethyl group enhances its lipophilicity and can influence its biological activity, making it of interest in medicinal chemistry. The 2,5-dimethylphenyl amino substituent adds steric bulk and may affect the compound's interaction with biological targets. Overall, this compound's unique structural features suggest potential applications in pharmaceuticals, particularly in the development of new therapeutic agents. Its specific properties, such as melting point, boiling point, and solubility, would need to be determined through experimental methods, as they are not universally defined and can vary based on purity and environmental conditions.
Formula:C15H15F3N2O2S
InChI:InChI=1S/C15H15F3N2O2S/c1-4-22-13(21)11-12(15(16,17)18)20-14(23-11)19-10-7-8(2)5-6-9(10)3/h5-7H,4H2,1-3H3,(H,19,20)
InChI key:InChIKey=QTKXSQWDKKWKRS-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=C(C(F)(F)F)N=C(NC2=C(C)C=CC(C)=C2)S1
Synonyms:- 5-Thiazolecarboxylic acid, 2-[(2,5-dimethylphenyl)amino]-4-(trifluoromethyl)-, ethyl ester
- Ethyl 2-[(2,5-dimethylphenyl)amino]-4-(trifluoromethyl)-5-thiazolecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.