CAS 937597-94-9

Ethyl 2-(ethylamino)-4-(trifluoromethyl)-5-thiazolecarboxylate

Description:

Ethyl 2-(ethylamino)-4-(trifluoromethyl)-5-thiazolecarboxylate is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound features an ethylamino group, contributing to its basicity and potential reactivity. The presence of a trifluoromethyl group enhances its lipophilicity and can influence its biological activity, making it of interest in medicinal chemistry. The ethyl ester functional group indicates that it can undergo hydrolysis to yield the corresponding carboxylic acid, which may have different properties and reactivity. This compound is likely to exhibit moderate to high stability under standard conditions, but its reactivity can be influenced by the presence of the electronegative trifluoromethyl group. Overall, its unique structural features suggest potential applications in pharmaceuticals or agrochemicals, although specific biological activities would require further investigation through experimental studies.

Formula: C₉H₁₁F₃N₂O₂S

InChI: InChI=1S/C9H11F3N2O2S/c1-3-13-8-14-6(9(10,11)12)5(17-8)7(15)16-4-2/h3-4H2,1-2H3,(H,13,14)

InChI key: InChIKey=ZFFLNXIHFHPELW-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C1=C(C(F)(F)F)N=C(NCC)S1

Synonyms:

• Ethyl 2-(ethylamino)-4-(trifluoromethyl)-5-thiazolecarboxylate
• 5-Thiazolecarboxylic acid, 2-(ethylamino)-4-(trifluoromethyl)-, ethyl ester