
CAS 937597-95-0
:4-(2,4-Dimethylphenoxy)-3-fluorobenzenamine
Description:
4-(2,4-Dimethylphenoxy)-3-fluorobenzenamine is an organic compound characterized by its complex structure, which includes a fluorobenzene moiety and a dimethylphenoxy group. This compound features a fluorine atom attached to a benzene ring, which can influence its reactivity and physical properties, such as polarity and solubility. The presence of the dimethylphenoxy group contributes to its hydrophobic characteristics, potentially affecting its interactions in biological systems. The amine functional group in the structure can participate in hydrogen bonding, making it relevant in various chemical reactions and applications, including pharmaceuticals and agrochemicals. The compound's molecular structure suggests it may exhibit specific biological activities, although detailed studies would be necessary to elucidate its exact properties and potential uses. As with many organic compounds, its stability, reactivity, and behavior in different environments would depend on factors such as pH, temperature, and the presence of other chemical species.
Formula:C14H14FNO
InChI:InChI=1S/C14H14FNO/c1-9-3-5-13(10(2)7-9)17-14-6-4-11(16)8-12(14)15/h3-8H,16H2,1-2H3
InChI key:InChIKey=KCVFQNUCSGZUOM-UHFFFAOYSA-N
SMILES:O(C1=C(C)C=C(C)C=C1)C2=C(F)C=C(N)C=C2
Synonyms:- Benzenamine, 4-(2,4-dimethylphenoxy)-3-fluoro-
- 4-(2,4-Dimethylphenoxy)-3-fluorobenzenamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.