
CAS 937597-99-4
:4-(3,4-Dimethylphenoxy)-3-fluorobenzenamine
Description:
4-(3,4-Dimethylphenoxy)-3-fluorobenzenamine, with the CAS number 937597-99-4, is an organic compound characterized by its aromatic structure, which includes a fluorobenzene moiety and a dimethylphenoxy group. This compound features a fluorine atom attached to the benzene ring, which can influence its reactivity and physical properties, such as polarity and solubility. The presence of the dimethyl groups on the phenoxy ring can enhance steric hindrance and affect the compound's interactions with biological targets or other chemical species. Typically, compounds like this may exhibit properties such as moderate to high lipophilicity, making them potentially useful in pharmaceutical applications or as intermediates in organic synthesis. Additionally, the specific arrangement of functional groups can lead to unique electronic properties, which may be exploited in various chemical reactions or applications. Safety and handling considerations are essential, as with any chemical substance, particularly regarding its potential toxicity and environmental impact.
Formula:C14H14FNO
InChI:InChI=1S/C14H14FNO/c1-9-3-5-12(7-10(9)2)17-14-6-4-11(16)8-13(14)15/h3-8H,16H2,1-2H3
InChI key:InChIKey=QQGJJWPKIIZNMH-UHFFFAOYSA-N
SMILES:O(C1=C(F)C=C(N)C=C1)C2=CC(C)=C(C)C=C2
Synonyms:- 4-(3,4-Dimethylphenoxy)-3-fluorobenzenamine
- Benzenamine, 4-(3,4-dimethylphenoxy)-3-fluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.