
CAS 937598-07-7
:3-Fluoro-4-(2-naphthalenyloxy)benzenamine
Description:
3-Fluoro-4-(2-naphthalenyloxy)benzenamine, with the CAS number 937598-07-7, is an organic compound characterized by the presence of a fluorine atom, an amine group, and a naphthalenyl ether moiety. This compound features a fluorobenzene ring substituted at the 3-position with a fluorine atom and at the 4-position with a naphthalenyloxy group, which contributes to its unique chemical properties. The presence of the amine group suggests potential for hydrogen bonding and reactivity, making it a candidate for various chemical reactions, including nucleophilic substitutions. The naphthalene component adds to the compound's hydrophobic character and may influence its solubility and interaction with biological systems. Additionally, the fluorine atom can enhance the compound's stability and lipophilicity, potentially affecting its pharmacokinetic properties. Overall, this compound's structure suggests it may have applications in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals, where modifications to aromatic systems are often explored for enhanced activity or selectivity.
Formula:C16H12FNO
InChI:InChI=1S/C16H12FNO/c17-15-10-13(18)6-8-16(15)19-14-7-5-11-3-1-2-4-12(11)9-14/h1-10H,18H2
InChI key:InChIKey=NBNQZMPXOQJNNY-UHFFFAOYSA-N
SMILES:O(C1=CC2=C(C=C1)C=CC=C2)C3=C(F)C=C(N)C=C3
Synonyms:- 3-Fluoro-4-(naphthalen-2-yloxy)aniline
- Benzenamine, 3-fluoro-4-(2-naphthalenyloxy)-
- 3-Fluoro-4-(2-naphthalenyloxy)benzenamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.