CAS 937598-10-2
:2,4-Dihydro-4-(2-methylpropyl)-5-(1,3,6-trimethyl-1H-pyrazolo[3,4-b]pyridin-4-yl)-3H-1,2,4-triazole-3-thione
Description:
2,4-Dihydro-4-(2-methylpropyl)-5-(1,3,6-trimethyl-1H-pyrazolo[3,4-b]pyridin-4-yl)-3H-1,2,4-triazole-3-thione is a complex organic compound characterized by its multi-ring structure and the presence of various functional groups. This substance features a triazole ring, which is known for its biological activity and potential applications in pharmaceuticals. The presence of a thione group (–C=S) contributes to its reactivity and may influence its interaction with biological targets. The compound also contains a pyrazolo-pyridine moiety, which can enhance its pharmacological properties. Its branched alkyl substituent (2-methylpropyl) may affect its solubility and lipophilicity, impacting its bioavailability. Overall, this compound's unique structural features suggest potential utility in medicinal chemistry, particularly in the development of new therapeutic agents. However, specific properties such as solubility, melting point, and biological activity would require empirical investigation to fully characterize its behavior and applications.
Formula:C15H20N6S
InChI:InChI=1S/C15H20N6S/c1-8(2)7-21-13(17-18-15(21)22)11-6-9(3)16-14-12(11)10(4)19-20(14)5/h6,8H,7H2,1-5H3,(H,18,22)
InChI key:InChIKey=WHAFSPGTTINFTE-UHFFFAOYSA-N
SMILES:CC=1C2=C(C=C(C)N=C2N(C)N1)C=3N(CC(C)C)C(=S)NN3
Synonyms:- 3H-1,2,4-Triazole-3-thione, 2,4-dihydro-4-(2-methylpropyl)-5-(1,3,6-trimethyl-1H-pyrazolo[3,4-b]pyridin-4-yl)-
- 2,4-Dihydro-4-(2-methylpropyl)-5-(1,3,6-trimethyl-1H-pyrazolo[3,4-b]pyridin-4-yl)-3H-1,2,4-triazole-3-thione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.