
CAS 937598-11-3
:4-(4-Ethoxyphenoxy)-3-fluorobenzenamine
Description:
4-(4-Ethoxyphenoxy)-3-fluorobenzenamine, identified by its CAS number 937598-11-3, is an organic compound characterized by its complex aromatic structure. It features a fluorine atom substituted on a benzene ring, which can influence its electronic properties and reactivity. The presence of an ethoxy group and a phenoxy linkage contributes to its solubility and potential interactions in various chemical environments. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of new therapeutic agents. Its molecular structure suggests potential for hydrogen bonding and other intermolecular interactions, which can affect its physical properties such as melting point, boiling point, and solubility in different solvents. Additionally, the presence of both electron-donating and electron-withdrawing groups can influence its reactivity in electrophilic and nucleophilic substitution reactions. Overall, 4-(4-Ethoxyphenoxy)-3-fluorobenzenamine is a compound of interest in both synthetic organic chemistry and medicinal chemistry due to its unique structural features.
Formula:C14H14FNO2
InChI:InChI=1S/C14H14FNO2/c1-2-17-11-4-6-12(7-5-11)18-14-8-3-10(16)9-13(14)15/h3-9H,2,16H2,1H3
InChI key:InChIKey=WWQYVTWLOKDQRB-UHFFFAOYSA-N
SMILES:O(C1=C(F)C=C(N)C=C1)C2=CC=C(OCC)C=C2
Synonyms:- 4-(4-Ethoxyphenoxy)-3-fluorobenzenamine
- Benzenamine, 4-(4-ethoxyphenoxy)-3-fluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.