CAS 937598-12-4
:3-Ethyl-2,3-dihydro-6-methyl-2-thioxothieno[2,3-d]pyrimidin-4(1H)-one
Description:
3-Ethyl-2,3-dihydro-6-methyl-2-thioxothieno[2,3-d]pyrimidin-4(1H)-one is a heterocyclic compound characterized by its unique thieno-pyrimidine structure, which incorporates both sulfur and nitrogen atoms. This compound features a thioxo group, contributing to its reactivity and potential biological activity. The presence of an ethyl group and a methyl group enhances its lipophilicity, which may influence its solubility and permeability in biological systems. The dihydro form indicates that it has a saturated ring structure, which can affect its stability and reactivity. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its specific interactions and applications would depend on further studies, including its mechanism of action, toxicity, and efficacy in biological systems. As with many heterocycles, it may serve as a scaffold for the development of new therapeutic agents. Overall, the unique structural features of this compound suggest potential utility in various chemical and pharmaceutical applications.
Formula:C9H10N2OS2
InChI:InChI=1S/C9H10N2OS2/c1-3-11-8(12)6-4-5(2)14-7(6)10-9(11)13/h4H,3H2,1-2H3,(H,10,13)
InChI key:InChIKey=GEBAIIFLBDDNRD-UHFFFAOYSA-N
SMILES:O=C1C2=C(NC(=S)N1CC)SC(C)=C2
Synonyms:- Thieno[2,3-d]pyrimidin-4(1H)-one, 3-ethyl-2,3-dihydro-6-methyl-2-thioxo-
- 3-Ethyl-2,3-dihydro-6-methyl-2-thioxothieno[2,3-d]pyrimidin-4(1H)-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.