CAS 937598-36-2

3-Fluoro-4-(4-pyridinylmethoxy)benzenamine

Description:

3-Fluoro-4-(4-pyridinylmethoxy)benzenamine is an organic compound characterized by its aromatic structure, which includes a fluorine atom and a pyridine ring. The presence of the fluorine atom at the 3-position of the benzene ring enhances the compound's lipophilicity and may influence its biological activity. The 4-(4-pyridinylmethoxy) substituent introduces a methoxy linkage to a pyridine moiety, which can contribute to the compound's solubility and reactivity. This compound is likely to exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can affect its interactions in biological systems. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Additionally, the presence of both aromatic and heteroaromatic components may provide unique electronic properties, making it a candidate for further research in drug design and synthesis. As with many compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₂H₁₁FN₂O

InChI: InChI=1S/C12H11FN2O/c13-11-7-10(14)1-2-12(11)16-8-9-3-5-15-6-4-9/h1-7H,8,14H2

InChI key: InChIKey=OZJMUNLTHBORMB-UHFFFAOYSA-N

SMILES: O(CC=1C=CN=CC1)C2=C(F)C=C(N)C=C2

Synonyms:

• 3-Fluoro-4-(4-pyridinylmethoxy)benzenamine
• Benzenamine, 3-fluoro-4-(4-pyridinylmethoxy)-