CAS 937598-40-8

Ethyl 4-(chloromethyl)-2-(propylamino)-5-thiazolecarboxylate

Description:

Ethyl 4-(chloromethyl)-2-(propylamino)-5-thiazolecarboxylate is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound features an ethyl ester functional group, contributing to its solubility and reactivity. The presence of a chloromethyl group indicates potential for nucleophilic substitution reactions, while the propylamino group suggests basic properties and potential interactions with biological systems. The thiazole moiety is known for its biological activity, often serving as a scaffold in medicinal chemistry. This compound may exhibit various pharmacological properties, making it of interest in drug development. Its molecular structure suggests it could participate in diverse chemical reactions, including acylation and alkylation. As with many thiazole derivatives, it may also display antimicrobial or anti-inflammatory activities, although specific biological data would be necessary to confirm these properties. Overall, this compound represents a versatile structure with potential applications in pharmaceuticals and organic synthesis.

Formula: C₁₀H₁₅ClN₂O₂S

InChI: InChI=1S/C10H15ClN2O2S/c1-3-5-12-10-13-7(6-11)8(16-10)9(14)15-4-2/h3-6H2,1-2H3,(H,12,13)

InChI key: InChIKey=JDUOUTRTOPCFAN-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C1=C(CCl)N=C(NCCC)S1

Synonyms:

• 5-Thiazolecarboxylic acid, 4-(chloromethyl)-2-(propylamino)-, ethyl ester
• Ethyl 4-(chloromethyl)-2-(propylamino)-5-thiazolecarboxylate