CAS 937598-42-0

4-(Cyclopropylmethoxy)-3-fluorobenzenamine

Description:

4-(Cyclopropylmethoxy)-3-fluorobenzenamine is an organic compound characterized by its unique molecular structure, which includes a fluorine atom, an amine group, and a cyclopropylmethoxy substituent on a benzene ring. The presence of the fluorine atom typically enhances the compound's lipophilicity and can influence its reactivity and biological activity. The cyclopropyl group contributes to the compound's three-dimensional shape, potentially affecting its interactions with biological targets. The methoxy group serves as an electron-donating substituent, which can stabilize the aromatic system and influence the compound's overall electronic properties. This compound may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry. Its specific characteristics, such as solubility, melting point, and reactivity, would depend on the overall molecular interactions and the environment in which it is studied. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₀H₁₂FNO

InChI: InChI=1S/C10H12FNO/c11-9-5-8(12)3-4-10(9)13-6-7-1-2-7/h3-5,7H,1-2,6,12H2

InChI key: InChIKey=VPVCNCVXXUJMLC-UHFFFAOYSA-N

SMILES: O(CC1CC1)C2=C(F)C=C(N)C=C2

Synonyms:

• 4-(Cyclopropylmethoxy)-3-fluorobenzenamine
• Benzenamine, 4-(cyclopropylmethoxy)-3-fluoro-
• [4-(Cyclopropylmethoxy)-3-fluorophenyl]amine
• 4-(Cyclopropylmethoxy)-3-fluoroaniline