CymitQuimica logo

CAS 937598-43-1

:

Ethyl 4-(chloromethyl)-2-(2-propen-1-ylamino)-5-thiazolecarboxylate

Description:
Ethyl 4-(chloromethyl)-2-(2-propen-1-ylamino)-5-thiazolecarboxylate is a synthetic organic compound characterized by its thiazole ring, which contributes to its biological activity. The presence of a chloromethyl group indicates potential reactivity, making it useful in various chemical transformations. The ethyl ester functional group suggests that it may exhibit moderate solubility in organic solvents, while the thiazole moiety can enhance its interaction with biological targets. The compound also features a propenylamino side chain, which may impart unique properties, such as increased lipophilicity or specific binding affinities. This structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. Its specific reactivity and biological properties would depend on the functional groups and their spatial arrangement, making it a candidate for further investigation in drug design or chemical synthesis. As with many synthetic compounds, safety and handling precautions should be observed due to the presence of reactive groups.
Formula:C10H13ClN2O2S
InChI:InChI=1S/C10H13ClN2O2S/c1-3-5-12-10-13-7(6-11)8(16-10)9(14)15-4-2/h3H,1,4-6H2,2H3,(H,12,13)
InChI key:InChIKey=QKFNABVIWZJFQW-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=C(CCl)N=C(NCC=C)S1
Synonyms:
  • 5-Thiazolecarboxylic acid, 4-(chloromethyl)-2-(2-propen-1-ylamino)-, ethyl ester
  • Ethyl 4-(chloromethyl)-2-(2-propen-1-ylamino)-5-thiazolecarboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.