
CAS 937598-44-2
:4-(1-Azabicyclo[2.2.2]oct-3-yloxy)-3-fluorobenzenamine
Description:
4-(1-Azabicyclo[2.2.2]oct-3-yloxy)-3-fluorobenzenamine is a chemical compound characterized by its unique bicyclic structure and functional groups. The presence of the azabicyclo[2.2.2]octane moiety indicates a nitrogen atom integrated into a bicyclic framework, which contributes to its potential biological activity and interaction with various receptors. The fluorobenzenamine portion of the molecule suggests that it may exhibit interesting electronic properties due to the electronegative fluorine atom, which can influence the compound's reactivity and solubility. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could interact with biological targets. Additionally, the compound's properties, such as solubility, stability, and potential toxicity, would be essential for evaluating its suitability for specific applications. As with many organic compounds, its synthesis, characterization, and potential applications would require thorough investigation to fully understand its behavior in various chemical and biological contexts.
Formula:C13H17FN2O
InChI:InChI=1S/C13H17FN2O/c14-11-7-10(15)1-2-12(11)17-13-8-16-5-3-9(13)4-6-16/h1-2,7,9,13H,3-6,8,15H2
InChI key:InChIKey=GDYFVLPXHUHZCD-UHFFFAOYSA-N
SMILES:O(C1C2CCN(C1)CC2)C3=C(F)C=C(N)C=C3
Synonyms:- 4-(1-Azabicyclo[2.2.2]oct-3-yloxy)-3-fluorobenzenamine
- Benzenamine, 4-(1-azabicyclo[2.2.2]oct-3-yloxy)-3-fluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.