CAS 937598-58-8

1-(4-Fluorophenyl)-3,6-dimethyl-1H-pyrazolo[3,4-b]pyridine-4-carboxylic acid hydrazide

Description:

1-(4-Fluorophenyl)-3,6-dimethyl-1H-pyrazolo[3,4-b]pyridine-4-carboxylic acid hydrazide, with CAS number 937598-58-8, is a chemical compound characterized by its complex structure, which includes a pyrazolo[3,4-b]pyridine core. This compound features a fluorophenyl group and a hydrazide functional group, contributing to its potential biological activity. The presence of the fluorine atom may enhance lipophilicity and influence the compound's interaction with biological targets. The dimethyl substitutions on the pyrazole ring can affect its electronic properties and steric hindrance, potentially impacting its reactivity and binding affinity. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry and drug development. Its hydrazide functionality could also suggest potential applications in the synthesis of other derivatives or in biological assays. As with many such compounds, understanding its solubility, stability, and reactivity under different conditions is crucial for its application in research and industry.

Formula: C₁₅H₁₄FN₅O

InChI: InChI=1S/C15H14FN5O/c1-8-7-12(15(22)19-17)13-9(2)20-21(14(13)18-8)11-5-3-10(16)4-6-11/h3-7H,17H2,1-2H3,(H,19,22)

InChI key: InChIKey=ZNYDSCBVZAYJJZ-UHFFFAOYSA-N

SMILES: C(NN)(=O)C1=C2C(N(N=C2C)C3=CC=C(F)C=C3)=NC(C)=C1

Synonyms:

• 1-(4-Fluorophenyl)-3,6-dimethyl-1H-pyrazolo[3,4-b]pyridine-4-carboxylic acid hydrazide
• 1H-Pyrazolo[3,4-b]pyridine-4-carboxylic acid, 1-(4-fluorophenyl)-3,6-dimethyl-, hydrazide

1-(4-Fluorophenyl)-3,6-dimethyl-1H-pyrazolo[3,4-b]pyridine-4-carbohydrazide

CAS: 937598-58-8

1-(4-Fluorophenyl)-3,6-dimethyl-1H-pyrazolo[3,4-b]pyridine-4-carbohydrazide

Purity: ≥95%

Molecular weight: 299.30g/mol

Ref: 54-PC410036