CAS 937598-70-4

1-[(4-Chlorophenyl)methyl]-6-cyclopropyl-3-methyl-1H-pyrazolo[3,4-b]pyridine-4-carboxylic acid

Description:

1-[(4-Chlorophenyl)methyl]-6-cyclopropyl-3-methyl-1H-pyrazolo[3,4-b]pyridine-4-carboxylic acid is a chemical compound characterized by its complex structure, which includes a pyrazolo[3,4-b]pyridine core, a carboxylic acid functional group, and various substituents that enhance its biological activity. The presence of the 4-chlorobenzyl group and the cyclopropyl moiety contributes to its unique pharmacological properties. This compound is often studied for its potential applications in medicinal chemistry, particularly in the development of novel therapeutic agents. Its molecular structure suggests that it may interact with specific biological targets, making it of interest in drug discovery. The compound's solubility, stability, and reactivity can be influenced by the functional groups present, which also play a crucial role in its biological activity. As with many pyrazole derivatives, it may exhibit a range of effects, including anti-inflammatory or analgesic properties, although specific biological data would be necessary to confirm these activities.

Formula: C₁₈H₁₆ClN₃O₂

InChI: InChI=1S/C18H16ClN3O2/c1-10-16-14(18(23)24)8-15(12-4-5-12)20-17(16)22(21-10)9-11-2-6-13(19)7-3-11/h2-3,6-8,12H,4-5,9H2,1H3,(H,23,24)

InChI key: InChIKey=UBIZVECNPADQIV-UHFFFAOYSA-N

SMILES: C(N1C=2C(=C(C(O)=O)C=C(N2)C3CC3)C(C)=N1)C4=CC=C(Cl)C=C4

Synonyms:

• 1-[(4-Chlorophenyl)methyl]-6-cyclopropyl-3-methyl-1H-pyrazolo[3,4-b]pyridine-4-carboxylic acid
• 1H-Pyrazolo[3,4-b]pyridine-4-carboxylic acid, 1-[(4-chlorophenyl)methyl]-6-cyclopropyl-3-methyl-