
CAS 937598-81-7
:4-(2-Phenyl-1H-imidazol-1-yl)benzenemethanamine
Description:
4-(2-Phenyl-1H-imidazol-1-yl)benzenemethanamine, with the CAS number 937598-81-7, is an organic compound characterized by its complex structure, which includes an imidazole ring and an amine group. This compound typically exhibits properties associated with aromatic amines, such as potential solubility in organic solvents and moderate stability under standard conditions. The presence of the imidazole moiety suggests potential biological activity, as imidazole derivatives are often found in pharmaceuticals and can interact with biological targets. The phenyl groups contribute to the compound's hydrophobic characteristics, influencing its interactions in biological systems. Additionally, the compound may exhibit fluorescence properties due to its conjugated system, making it of interest in various applications, including medicinal chemistry and materials science. Its synthesis and reactivity can be influenced by the functional groups present, allowing for potential modifications to enhance its properties or biological activity. Overall, this compound represents a class of substances with diverse applications in research and industry.
Formula:C16H15N3
InChI:InChI=1S/C16H15N3/c17-12-13-6-8-15(9-7-13)19-11-10-18-16(19)14-4-2-1-3-5-14/h1-11H,12,17H2
InChI key:InChIKey=KEUMKOMTMPIBOO-UHFFFAOYSA-N
SMILES:C(N)C1=CC=C(N2C(=NC=C2)C3=CC=CC=C3)C=C1
Synonyms:- [4-(2-Phenyl-1H-imidazol-1-yl)phenyl]methanamine
- Benzenemethanamine, 4-(2-phenyl-1H-imidazol-1-yl)-
- [4-(2-Phenylimidazol-1-yl)phenyl]methanamine
- 1-[4-(2-Phenyl-1H-imidazol-1-yl)phenyl]methanamine
- 4-(2-Phenyl-1H-imidazol-1-yl)benzenemethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.