CAS 937598-82-8

6-(4-Methoxyphenyl)-1,3-dimethyl-1H-pyrazolo[3,4-b]pyridine-4-carboxylic acid

Description:

6-(4-Methoxyphenyl)-1,3-dimethyl-1H-pyrazolo[3,4-b]pyridine-4-carboxylic acid is a chemical compound characterized by its complex structure, which includes a pyrazolo[3,4-b]pyridine core substituted with a methoxyphenyl group and a carboxylic acid functional group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in medicinal chemistry. The presence of the methoxy group can influence its electronic properties and reactivity, while the carboxylic acid group may contribute to its acidity and ability to form salts or participate in hydrogen bonding. The compound's structure suggests potential applications in drug development, particularly in targeting specific biological pathways. Additionally, its molecular interactions and stability can be influenced by factors such as pH and solvent environment. Overall, this compound represents a class of heterocyclic compounds that are often explored for their pharmacological properties.

Formula: C₁₆H₁₅N₃O₃

InChI: InChI=1S/C16H15N3O3/c1-9-14-12(16(20)21)8-13(17-15(14)19(2)18-9)10-4-6-11(22-3)7-5-10/h4-8H,1-3H3,(H,20,21)

InChI key: InChIKey=PCYQGPIZKCGPCX-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C2C(=NC(=C1)C3=CC=C(OC)C=C3)N(C)N=C2C

Synonyms:

• 6-(4-Methoxyphenyl)-1,3-dimethyl-1H-pyrazolo[3,4-b]pyridine-4-carboxylic acid
• 1H-Pyrazolo[3,4-b]pyridine-4-carboxylic acid, 6-(4-methoxyphenyl)-1,3-dimethyl-

6-(4-methoxyphenyl)-1,3-dimethyl-1H-pyrazolo[3,4-b]pyridine-4-carboxylic acid

CAS: 937598-82-8

Purity: 95.0%

Molecular weight: 297.3139953613281

Ref: 10-F426606

6-(4-Methoxyphenyl)-1,3-dimethyl-1H-pyrazolo[3,4-b]pyridine-4-carboxylic acid

CAS: 937598-82-8

Versatile small molecule scaffold

Formula: C₁₆H₁₅N₃O₃

Purity: Min. 95%

Molecular weight: 297.31 g/mol

Ref: 3D-MMB59882