CymitQuimica logo

CAS 937599-01-4

:

4-(2-Naphthalenyloxy)benzenemethanamine

Description:
4-(2-Naphthalenyloxy)benzenemethanamine, identified by its CAS number 937599-01-4, is an organic compound characterized by its complex structure that includes a naphthalene moiety linked to a benzene ring through an ether bond, with an amine functional group attached to the benzyl carbon. This compound typically exhibits properties associated with aromatic amines, such as moderate solubility in organic solvents and potential reactivity due to the presence of the amine group. It may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it of interest in synthetic organic chemistry. The presence of the naphthalene group can also impart unique optical properties, potentially making it useful in applications related to dyes or pharmaceuticals. Additionally, the compound's structure suggests it may have biological activity, warranting further investigation into its pharmacological properties. Safety and handling precautions should be observed, as with many aromatic amines, due to potential toxicity and environmental concerns.
Formula:C17H15NO
InChI:InChI=1S/C17H15NO/c18-12-13-5-8-16(9-6-13)19-17-10-7-14-3-1-2-4-15(14)11-17/h1-11H,12,18H2
InChI key:InChIKey=FECRECSNUMCNBK-UHFFFAOYSA-N
SMILES:O(C1=CC2=C(C=C1)C=CC=C2)C3=CC=C(CN)C=C3
Synonyms:
  • [4-(Naphthalen-2-yloxy)phenyl]methanamine
  • 4-(2-Naphthalenyloxy)benzenemethanamine
  • Benzenemethanamine, 4-(2-naphthalenyloxy)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.