CAS 937599-56-9

3-(Difluoromethyl)-5,6-dihydro-1(4H)-cyclopentapyrazoleacetic acid

Description:

3-(Difluoromethyl)-5,6-dihydro-1(4H)-cyclopentapyrazoleacetic acid, identified by its CAS number 937599-56-9, is a chemical compound characterized by its unique structural features, including a cyclopentapyrazole framework and a difluoromethyl group. This compound typically exhibits properties associated with both acidic and basic functionalities due to the presence of the carboxylic acid moiety. Its difluoromethyl group can influence its reactivity and polarity, potentially enhancing its biological activity or solubility in various solvents. The cyclopentapyrazole structure may contribute to its stability and may also play a role in its interaction with biological targets. As with many pyrazole derivatives, this compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. However, specific details regarding its physical properties, such as melting point, boiling point, and solubility, would require empirical data or literature references for precise characterization. Overall, this compound represents a fascinating example of the diversity found in organic chemistry and its potential applications.

Formula: C₉H₁₀F₂N₂O₂

InChI: InChI=1S/C9H10F2N2O2/c10-9(11)8-5-2-1-3-6(5)13(12-8)4-7(14)15/h9H,1-4H2,(H,14,15)

InChI key: InChIKey=ZJIPBXQIWJMYGR-UHFFFAOYSA-N

SMILES: C(F)(F)C=1C2=C(N(CC(O)=O)N1)CCC2

Synonyms:

• 3-(Difluoromethyl)-5,6-dihydro-1(4H)-cyclopentapyrazoleacetic acid
• [3-(Difluoromethyl)-5,6-dihydrocyclopenta[c]pyrazol-1(4H)-yl]acetic acid
• 1(4H)-Cyclopentapyrazoleacetic acid, 3-(difluoromethyl)-5,6-dihydro-
• 2-[3-(Difluoromethyl)-1H,4H,5H,6H-cyclopenta[c]pyrazol-1-yl]acetic acid

2-[3-(Difluoromethyl)-1H,4H,5H,6H-cyclopenta[C]pyrazol-1-yl]acetic acid

CAS: 937599-56-9

Versatile small molecule scaffold

Formula: C₉H₁₀F₂N₂O₂

Purity: Min. 95%

Molecular weight: 216.18 g/mol

Ref: 3D-MMB59956