CAS 937599-65-0

3-Phenyl-6-(2-thienyl)isoxazolo[5,4-b]pyridine-4-carboxylic acid hydrazide

Description:

3-Phenyl-6-(2-thienyl)isoxazolo[5,4-b]pyridine-4-carboxylic acid hydrazide is a complex organic compound characterized by its unique structural features, which include an isoxazole ring fused with a pyridine moiety and functional groups such as a phenyl and thienyl substituent. This compound is likely to exhibit a range of biological activities due to the presence of the hydrazide functional group, which can participate in various chemical reactions, including hydrazone formation. The isoxazole and pyridine rings contribute to its potential as a pharmacophore, making it of interest in medicinal chemistry. The compound's solubility, stability, and reactivity can be influenced by the presence of the carboxylic acid and hydrazide groups, which may also affect its interaction with biological targets. Additionally, the presence of sulfur in the thienyl group may impart unique electronic properties. Overall, this compound's intricate structure suggests potential applications in drug development and materials science, although specific biological activities and properties would require empirical investigation.

Formula: C₁₇H₁₂N₄O₂S

InChI: InChI=1S/C17H12N4O2S/c18-20-16(22)11-9-12(13-7-4-8-24-13)19-17-14(11)15(21-23-17)10-5-2-1-3-6-10/h1-9H,18H2,(H,20,22)

InChI key: InChIKey=PDJGLWJHDJGIRC-UHFFFAOYSA-N

SMILES: C(NN)(=O)C1=C2C(=NOC2=NC(=C1)C3=CC=CS3)C4=CC=CC=C4

Synonyms:

• Isoxazolo[5,4-b]pyridine-4-carboxylic acid, 3-phenyl-6-(2-thienyl)-, hydrazide
• 3-Phenyl-6-(2-thienyl)isoxazolo[5,4-b]pyridine-4-carboxylic acid hydrazide