CymitQuimica logo

CAS 937599-68-3

:

1-Ethyl-2,3-dihydro-5,7-dimethyl-2-thioxopyrido[2,3-d]pyrimidin-4(1H)-one

Description:
1-Ethyl-2,3-dihydro-5,7-dimethyl-2-thioxopyrido[2,3-d]pyrimidin-4(1H)-one is a heterocyclic compound characterized by its complex structure, which includes a pyrimidine ring fused with a pyridine moiety. This compound features a thioxo group, contributing to its unique reactivity and potential biological activity. The presence of ethyl and methyl substituents enhances its lipophilicity, which may influence its pharmacokinetic properties. Typically, compounds of this nature are investigated for their potential therapeutic applications, particularly in medicinal chemistry, due to their ability to interact with biological targets. The thioxopyrimidine framework is known for its diverse biological activities, including antimicrobial and anticancer properties. As with many heterocycles, the specific arrangement of substituents can significantly affect the compound's stability, solubility, and overall reactivity. Further studies, including synthesis and biological evaluation, are essential to fully understand the potential applications and mechanisms of action of this compound.
Formula:C11H13N3OS
InChI:InChI=1S/C11H13N3OS/c1-4-14-9-8(10(15)13-11(14)16)6(2)5-7(3)12-9/h5H,4H2,1-3H3,(H,13,15,16)
InChI key:InChIKey=AIRQBJQNEUVBLH-UHFFFAOYSA-N
SMILES:C(C)N1C=2C(C(=O)NC1=S)=C(C)C=C(C)N2
Synonyms:
  • Pyrido[2,3-d]pyrimidin-4(1H)-one, 1-ethyl-2,3-dihydro-5,7-dimethyl-2-thioxo-
  • 1-Ethyl-2,3-dihydro-5,7-dimethyl-2-thioxopyrido[2,3-d]pyrimidin-4(1H)-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.