CAS 937601-40-6

Ethyl 2-methyl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-5-carboxylate

Description:

Ethyl 2-methyl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-5-carboxylate is a chemical compound characterized by its complex heterocyclic structure, which includes a pyrazolo-pyrimidine framework. This compound features a trifluoromethyl group, which is known for enhancing lipophilicity and biological activity, making it of interest in medicinal chemistry. The ethyl ester functional group contributes to its reactivity and solubility properties, potentially influencing its pharmacokinetics. The presence of the methyl group at the 2-position of the pyrazolo ring may affect the compound's steric and electronic properties, which can be crucial for its interaction with biological targets. Additionally, the carboxylate moiety can participate in various chemical reactions, including esterification and hydrolysis. Overall, this compound's unique structural features suggest potential applications in drug development, particularly in areas requiring compounds with specific biological activities. However, detailed studies on its biological properties and mechanisms of action would be necessary to fully understand its potential uses.

Formula: C₁₁H₁₀F₃N₃O₂

InChI: InChI=1S/C11H10F3N3O2/c1-3-19-10(18)7-5-8(11(12,13)14)17-9(15-7)4-6(2)16-17/h4-5H,3H2,1-2H3

InChI key: InChIKey=TWWVCVOSWPZQIR-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C=1N2C(N=C(C(OCC)=O)C1)=CC(C)=N2

Synonyms:

• Ethyl 2-methyl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-5-carboxylate
• Pyrazolo[1,5-a]pyrimidine-5-carboxylic acid, 2-methyl-7-(trifluoromethyl)-, ethyl ester