CAS 937601-43-9

5,7-Bis(difluoromethyl)-3-nitropyrazolo[1,5-a]pyrimidine-2-carboxylic acid

Description:

5,7-Bis(difluoromethyl)-3-nitropyrazolo[1,5-a]pyrimidine-2-carboxylic acid is a heterocyclic compound characterized by its complex structure, which includes a pyrazolo-pyrimidine core. This compound features two difluoromethyl groups and a nitro group, contributing to its unique chemical properties and potential biological activity. The presence of the carboxylic acid functional group suggests that it can participate in acid-base reactions and may exhibit solubility in polar solvents. The difluoromethyl groups enhance lipophilicity and may influence the compound's interaction with biological targets. Additionally, the nitro group can serve as a site for further chemical modifications or reactions. This compound may be of interest in medicinal chemistry, particularly for its potential applications in drug development, given the significance of pyrazolo-pyrimidine derivatives in various therapeutic areas. However, specific biological activity, toxicity, and stability data would require further investigation through experimental studies.

Formula: C₉H₄F₄N₄O₄

InChI: InChI=1S/C9H4F4N4O4/c10-6(11)2-1-3(7(12)13)16-8(14-2)5(17(20)21)4(15-16)9(18)19/h1,6-7H,(H,18,19)

InChI key: InChIKey=VBPWHOOONFFZEJ-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C2N(C(C(F)F)=CC(C(F)F)=N2)N=C1C(O)=O

Synonyms:

• 5,7-Bis(difluoromethyl)-3-nitropyrazolo[1,5-a]pyrimidine-2-carboxylic acid
• Pyrazolo[1,5-a]pyrimidine-2-carboxylic acid, 5,7-bis(difluoromethyl)-3-nitro-