CymitQuimica logo

CAS 937601-48-4

:

1,1-Dimethylethyl 4-[4-(methoxycarbonyl)-2-oxo-1-pyrrolidinyl]-1-piperidinecarboxylate

Description:
1,1-Dimethylethyl 4-[4-(methoxycarbonyl)-2-oxo-1-pyrrolidinyl]-1-piperidinecarboxylate, identified by its CAS number 937601-48-4, is a chemical compound characterized by its complex structure that includes a piperidine ring and a pyrrolidine moiety. The presence of a methoxycarbonyl group indicates that it has an ester functional group, which contributes to its reactivity and solubility properties. This compound is likely to exhibit moderate polarity due to the presence of both hydrophobic (alkyl groups) and hydrophilic (ester and carbonyl groups) components. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as the piperidine and pyrrolidine rings are common in biologically active compounds. Additionally, the presence of multiple functional groups may allow for further chemical modifications, enhancing its utility in synthetic chemistry. Overall, this compound's unique structural features may contribute to its biological activity and potential therapeutic applications.
Formula:C16H26N2O5
InChI:InChI=1S/C16H26N2O5/c1-16(2,3)23-15(21)17-7-5-12(6-8-17)18-10-11(9-13(18)19)14(20)22-4/h11-12H,5-10H2,1-4H3
InChI key:InChIKey=HDJKYBGHNCMEQO-UHFFFAOYSA-N
SMILES:O=C1N(CC(C(OC)=O)C1)C2CCN(C(OC(C)(C)C)=O)CC2
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.